N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | G528-0496 |
| Compound Name: | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(4-methoxyphenyl)-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 352.34 |
| Molecular Formula: | C19 H16 N2 O5 |
| Smiles: | COc1ccc(cc1)c1c(C(Nc2ccc3c(c2)OCCO3)=O)nco1 |
| Stereo: | ACHIRAL |
| logP: | 2.3749 |
| logD: | 2.3748 |
| logSw: | -3.0351 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.533 |
| InChI Key: | WJMRAGMAJIKBML-UHFFFAOYSA-N |