N-butyl-5-(thiophen-2-yl)-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
N-butyl-5-(thiophen-2-yl)-1,3-oxazole-4-carboxamide
N-butyl-5-(thiophen-2-yl)-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | G528-0882 |
| Compound Name: | N-butyl-5-(thiophen-2-yl)-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 250.32 |
| Molecular Formula: | C12 H14 N2 O2 S |
| Smiles: | CCCCNC(c1c(c2cccs2)ocn1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5747 |
| logD: | 2.5747 |
| logSw: | -2.8571 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.619 |
| InChI Key: | RLYWOTHLNMZIEW-UHFFFAOYSA-N |