5-(3-methoxyphenyl)-N-[3-(methylsulfanyl)phenyl]-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
5-(3-methoxyphenyl)-N-[3-(methylsulfanyl)phenyl]-1,3-oxazole-4-carboxamide
5-(3-methoxyphenyl)-N-[3-(methylsulfanyl)phenyl]-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | G528-1503 |
| Compound Name: | 5-(3-methoxyphenyl)-N-[3-(methylsulfanyl)phenyl]-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 340.4 |
| Molecular Formula: | C18 H16 N2 O3 S |
| Smiles: | COc1cccc(c1)c1c(C(Nc2cccc(c2)SC)=O)nco1 |
| Stereo: | ACHIRAL |
| logP: | 3.8313 |
| logD: | 3.8313 |
| logSw: | -4.1707 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.71 |
| InChI Key: | AMNPJXXHAJAVQX-UHFFFAOYSA-N |