N-(3-chloro-2-methylphenyl)-5-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
N-(3-chloro-2-methylphenyl)-5-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide
N-(3-chloro-2-methylphenyl)-5-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | G528-2492 |
| Compound Name: | N-(3-chloro-2-methylphenyl)-5-(3,4-dimethoxyphenyl)-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 372.81 |
| Molecular Formula: | C19 H17 Cl N2 O4 |
| Smiles: | Cc1c(cccc1[Cl])NC(c1c(c2ccc(c(c2)OC)OC)ocn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.938 |
| logD: | 3.9379 |
| logSw: | -4.3864 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.729 |
| InChI Key: | OIFDHERXAVTOPP-UHFFFAOYSA-N |