5-(3,4-dimethoxyphenyl)-N-(3,4-dimethylphenyl)-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
5-(3,4-dimethoxyphenyl)-N-(3,4-dimethylphenyl)-1,3-oxazole-4-carboxamide
5-(3,4-dimethoxyphenyl)-N-(3,4-dimethylphenyl)-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | G528-2510 |
| Compound Name: | 5-(3,4-dimethoxyphenyl)-N-(3,4-dimethylphenyl)-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 352.39 |
| Molecular Formula: | C20 H20 N2 O4 |
| Smiles: | Cc1ccc(cc1C)NC(c1c(c2ccc(c(c2)OC)OC)ocn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9199 |
| logD: | 3.9199 |
| logSw: | -4.1011 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.427 |
| InChI Key: | PVKIBVDNLYZLPY-UHFFFAOYSA-N |