2,4-dimethyl-N-({1-[(4-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)benzene-1-sulfonamide
Chemical Structure Depiction of
2,4-dimethyl-N-({1-[(4-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)benzene-1-sulfonamide
2,4-dimethyl-N-({1-[(4-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G529-0629 |
| Compound Name: | 2,4-dimethyl-N-({1-[(4-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)benzene-1-sulfonamide |
| Molecular Weight: | 368.5 |
| Molecular Formula: | C21 H24 N2 O2 S |
| Smiles: | Cc1ccc(Cn2cccc2CNS(c2ccc(C)cc2C)(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.9367 |
| logD: | 4.9349 |
| logSw: | -4.5351 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.067 |
| InChI Key: | RPOPZHSHJPTAEQ-UHFFFAOYSA-N |