N-[(furan-2-yl)methyl]-N'-[2-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethyl]urea
					Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-N'-[2-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethyl]urea
			N-[(furan-2-yl)methyl]-N'-[2-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethyl]urea
Compound characteristics
| Compound ID: | G531-0070 | 
| Compound Name: | N-[(furan-2-yl)methyl]-N'-[2-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethyl]urea | 
| Molecular Weight: | 276.34 | 
| Molecular Formula: | C14 H20 N4 O2 | 
| Smiles: | Cc1c(CCNC(NCc2ccco2)=O)c(C)n(C)n1 | 
| Stereo: | ACHIRAL | 
| logP: | 0.6953 | 
| logD: | 0.6949 | 
| logSw: | -1.5397 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 57.615 | 
| InChI Key: | XRLCQMDYERAZAG-UHFFFAOYSA-N | 
 
				 
				