N'-(3-bromophenyl)-N-methyl-N-[2-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethyl]urea
Chemical Structure Depiction of
N'-(3-bromophenyl)-N-methyl-N-[2-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethyl]urea
N'-(3-bromophenyl)-N-methyl-N-[2-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethyl]urea
Compound characteristics
| Compound ID: | G531-0200 |
| Compound Name: | N'-(3-bromophenyl)-N-methyl-N-[2-(1,3,5-trimethyl-1H-pyrazol-4-yl)ethyl]urea |
| Molecular Weight: | 365.27 |
| Molecular Formula: | C16 H21 Br N4 O |
| Smiles: | Cc1c(CCN(C)C(Nc2cccc(c2)[Br])=O)c(C)n(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.7109 |
| logD: | 2.7106 |
| logSw: | -3.1427 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.028 |
| InChI Key: | KRXNQQHNDSEGFT-UHFFFAOYSA-N |