N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N'-(4-methoxyphenyl)-N-methylurea
Chemical Structure Depiction of
N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N'-(4-methoxyphenyl)-N-methylurea
N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N'-(4-methoxyphenyl)-N-methylurea
Compound characteristics
| Compound ID: | G531-0279 |
| Compound Name: | N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N'-(4-methoxyphenyl)-N-methylurea |
| Molecular Weight: | 330.43 |
| Molecular Formula: | C18 H26 N4 O2 |
| Smiles: | CCn1c(C)c(CCN(C)C(Nc2ccc(cc2)OC)=O)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.424 |
| logD: | 2.4234 |
| logSw: | -2.8342 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.01 |
| InChI Key: | DPBQUAMGEDVTAE-UHFFFAOYSA-N |