N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-N'-(3,4,5-trimethoxyphenyl)urea
Chemical Structure Depiction of
N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-N'-(3,4,5-trimethoxyphenyl)urea
N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-N'-(3,4,5-trimethoxyphenyl)urea
Compound characteristics
| Compound ID: | G531-0297 |
| Compound Name: | N-[2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-N'-(3,4,5-trimethoxyphenyl)urea |
| Molecular Weight: | 390.48 |
| Molecular Formula: | C20 H30 N4 O4 |
| Smiles: | CCn1c(C)c(CCN(C)C(Nc2cc(c(c(c2)OC)OC)OC)=O)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 1.8222 |
| logD: | 1.8214 |
| logSw: | -2.5097 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.444 |
| InChI Key: | CZWWVVSNMZETQB-UHFFFAOYSA-N |