N-(4-methylphenyl)-N'-[(1,3,5-trimethyl-1H-pyrazol-4-yl)methyl]urea
Chemical Structure Depiction of
N-(4-methylphenyl)-N'-[(1,3,5-trimethyl-1H-pyrazol-4-yl)methyl]urea
N-(4-methylphenyl)-N'-[(1,3,5-trimethyl-1H-pyrazol-4-yl)methyl]urea
Compound characteristics
| Compound ID: | G532-0020 |
| Compound Name: | N-(4-methylphenyl)-N'-[(1,3,5-trimethyl-1H-pyrazol-4-yl)methyl]urea |
| Molecular Weight: | 272.35 |
| Molecular Formula: | C15 H20 N4 O |
| Smiles: | Cc1ccc(cc1)NC(NCc1c(C)nn(C)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0579 |
| logD: | 2.0579 |
| logSw: | -2.7213 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.703 |
| InChI Key: | LUGIBVRSLFRXKY-UHFFFAOYSA-N |