2-(2-{[2-(benzylamino)-2-oxoethyl]sulfanyl}-1H-benzimidazol-1-yl)-N-(3,5-dimethoxyphenyl)acetamide
Chemical Structure Depiction of
2-(2-{[2-(benzylamino)-2-oxoethyl]sulfanyl}-1H-benzimidazol-1-yl)-N-(3,5-dimethoxyphenyl)acetamide
2-(2-{[2-(benzylamino)-2-oxoethyl]sulfanyl}-1H-benzimidazol-1-yl)-N-(3,5-dimethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | G534-0525 |
| Compound Name: | 2-(2-{[2-(benzylamino)-2-oxoethyl]sulfanyl}-1H-benzimidazol-1-yl)-N-(3,5-dimethoxyphenyl)acetamide |
| Molecular Weight: | 490.58 |
| Molecular Formula: | C26 H26 N4 O4 S |
| Smiles: | COc1cc(cc(c1)OC)NC(Cn1c2ccccc2nc1SCC(NCc1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6031 |
| logD: | 4.6025 |
| logSw: | -4.3965 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.186 |
| InChI Key: | ULRLDBAZGGNDHT-UHFFFAOYSA-N |