N-methyl-2-({1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-1H-benzimidazol-2-yl}sulfanyl)-N-phenylacetamide
Chemical Structure Depiction of
N-methyl-2-({1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-1H-benzimidazol-2-yl}sulfanyl)-N-phenylacetamide
N-methyl-2-({1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-1H-benzimidazol-2-yl}sulfanyl)-N-phenylacetamide
Compound characteristics
| Compound ID: | G534-0921 |
| Compound Name: | N-methyl-2-({1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]-1H-benzimidazol-2-yl}sulfanyl)-N-phenylacetamide |
| Molecular Weight: | 436.58 |
| Molecular Formula: | C24 H28 N4 O2 S |
| Smiles: | CC1CCCCN1C(Cn1c2ccccc2nc1SCC(N(C)c1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.517 |
| logD: | 3.5101 |
| logSw: | -3.7302 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.268 |
| InChI Key: | FBTBTTVZGYELTR-SFHVURJKSA-N |