2-({1-[(2-chloro-4-fluorophenyl)methyl]-1H-benzimidazol-2-yl}sulfanyl)-N-(4-fluorophenyl)-N-methylacetamide
Chemical Structure Depiction of
2-({1-[(2-chloro-4-fluorophenyl)methyl]-1H-benzimidazol-2-yl}sulfanyl)-N-(4-fluorophenyl)-N-methylacetamide
2-({1-[(2-chloro-4-fluorophenyl)methyl]-1H-benzimidazol-2-yl}sulfanyl)-N-(4-fluorophenyl)-N-methylacetamide
Compound characteristics
| Compound ID: | G534-1249 |
| Compound Name: | 2-({1-[(2-chloro-4-fluorophenyl)methyl]-1H-benzimidazol-2-yl}sulfanyl)-N-(4-fluorophenyl)-N-methylacetamide |
| Molecular Weight: | 457.93 |
| Molecular Formula: | C23 H18 Cl F2 N3 O S |
| Smiles: | CN(C(CSc1nc2ccccc2n1Cc1ccc(cc1[Cl])F)=O)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 5.6503 |
| logD: | 5.6498 |
| logSw: | -5.907 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 25.5906 |
| InChI Key: | BJDPLUSARCETRK-UHFFFAOYSA-N |