2-(2-{[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl}-1H-benzimidazol-1-yl)-N-(2-methylphenyl)acetamide
Chemical Structure Depiction of
2-(2-{[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl}-1H-benzimidazol-1-yl)-N-(2-methylphenyl)acetamide
2-(2-{[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl}-1H-benzimidazol-1-yl)-N-(2-methylphenyl)acetamide
Compound characteristics
| Compound ID: | G534-2558 |
| Compound Name: | 2-(2-{[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl}-1H-benzimidazol-1-yl)-N-(2-methylphenyl)acetamide |
| Molecular Weight: | 460.55 |
| Molecular Formula: | C25 H24 N4 O3 S |
| Smiles: | Cc1ccccc1NC(Cn1c2ccccc2nc1SCC(Nc1ccc(cc1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5599 |
| logD: | 4.5599 |
| logSw: | -4.322 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.622 |
| InChI Key: | AZANJMBLMWDOHV-UHFFFAOYSA-N |