4-({[4-(4-fluorophenyl)piperazin-1-yl][(2-phenylethyl)amino]methylidene}amino)benzoic acid--trifluoroacetic acid (1/1)
Chemical Structure Depiction of
4-({[4-(4-fluorophenyl)piperazin-1-yl][(2-phenylethyl)amino]methylidene}amino)benzoic acid--trifluoroacetic acid (1/1)
4-({[4-(4-fluorophenyl)piperazin-1-yl][(2-phenylethyl)amino]methylidene}amino)benzoic acid--trifluoroacetic acid (1/1)
Compound characteristics
| Compound ID: | G537-0304 |
| Compound Name: | 4-({[4-(4-fluorophenyl)piperazin-1-yl][(2-phenylethyl)amino]methylidene}amino)benzoic acid--trifluoroacetic acid (1/1) |
| Molecular Weight: | 560.55 |
| Molecular Formula: | C26 H27 F N4 O2 |
| Salt: | CF3COOH |
| Smiles: | C(CN/C(=N/c1ccc(cc1)C(O)=O)N1CCN(CC1)c1ccc(cc1)F)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.7703 |
| logD: | 4.7703 |
| logSw: | -4.5351 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.796 |
| InChI Key: | ZOOUJLAKWLGTSQ-UHFFFAOYSA-N |