N-(2,4-difluorophenyl)-1-(4-fluorophenyl)-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-c]pyridine-2(1H)-carboxamide
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-1-(4-fluorophenyl)-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-c]pyridine-2(1H)-carboxamide
N-(2,4-difluorophenyl)-1-(4-fluorophenyl)-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-c]pyridine-2(1H)-carboxamide
Compound characteristics
| Compound ID: | G539-0849 |
| Compound Name: | N-(2,4-difluorophenyl)-1-(4-fluorophenyl)-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-c]pyridine-2(1H)-carboxamide |
| Molecular Weight: | 442.5 |
| Molecular Formula: | C24 H21 F3 N2 O S |
| Smiles: | C1CCc2c(C1)c1CCN(C(c3ccc(cc3)F)c1s2)C(Nc1ccc(cc1F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.7037 |
| logD: | 6.7035 |
| logSw: | -6.0701 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.9232 |
| InChI Key: | LKNXSPYYUKRCCK-JOCHJYFZSA-N |