5-(4-fluorophenyl)-4-(piperidin-1-yl)thieno[2,3-d]pyrimidine
Chemical Structure Depiction of
5-(4-fluorophenyl)-4-(piperidin-1-yl)thieno[2,3-d]pyrimidine
5-(4-fluorophenyl)-4-(piperidin-1-yl)thieno[2,3-d]pyrimidine
Compound characteristics
| Compound ID: | G540-0084 |
| Compound Name: | 5-(4-fluorophenyl)-4-(piperidin-1-yl)thieno[2,3-d]pyrimidine |
| Molecular Weight: | 313.39 |
| Molecular Formula: | C17 H16 F N3 S |
| Smiles: | C1CCN(CC1)c1c2c(csc2ncn1)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 4.9256 |
| logD: | 4.9216 |
| logSw: | -4.986 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 24.2669 |
| InChI Key: | GURASTYUHPOUKX-UHFFFAOYSA-N |