N-benzyl-5-(4-methoxyphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-benzyl-5-(4-methoxyphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine
N-benzyl-5-(4-methoxyphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | G540-0434 |
| Compound Name: | N-benzyl-5-(4-methoxyphenyl)-N-methylthieno[2,3-d]pyrimidin-4-amine |
| Molecular Weight: | 361.46 |
| Molecular Formula: | C21 H19 N3 O S |
| Smiles: | CN(Cc1ccccc1)c1c2c(csc2ncn1)c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 5.4021 |
| logD: | 5.3961 |
| logSw: | -5.6632 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 31.3129 |
| InChI Key: | CNVHEEKYTAWHNU-UHFFFAOYSA-N |