5-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine
Chemical Structure Depiction of
5-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine
5-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | G540-0442 |
| Compound Name: | 5-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| Molecular Weight: | 377.46 |
| Molecular Formula: | C21 H19 N3 O2 S |
| Smiles: | COc1ccc(cc1)c1csc2c1c(NCc1ccccc1OC)ncn2 |
| Stereo: | ACHIRAL |
| logP: | 4.973 |
| logD: | 4.9717 |
| logSw: | -4.847 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.93 |
| InChI Key: | SRLTYOUZNCCMBY-UHFFFAOYSA-N |