5-(4-methoxyphenyl)-4-(piperidin-1-yl)thieno[2,3-d]pyrimidine
Chemical Structure Depiction of
5-(4-methoxyphenyl)-4-(piperidin-1-yl)thieno[2,3-d]pyrimidine
5-(4-methoxyphenyl)-4-(piperidin-1-yl)thieno[2,3-d]pyrimidine
Compound characteristics
| Compound ID: | G540-0488 |
| Compound Name: | 5-(4-methoxyphenyl)-4-(piperidin-1-yl)thieno[2,3-d]pyrimidine |
| Molecular Weight: | 325.43 |
| Molecular Formula: | C18 H19 N3 O S |
| Smiles: | COc1ccc(cc1)c1csc2c1c(ncn2)N1CCCCC1 |
| Stereo: | ACHIRAL |
| logP: | 4.8789 |
| logD: | 4.8749 |
| logSw: | -4.7232 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 31.811 |
| InChI Key: | BSJDWQAJDNMFBF-UHFFFAOYSA-N |