N~1~-cyclohexyl-N~2~-[5-(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]-N~1~-methylethane-1,2-diamine
Chemical Structure Depiction of
N~1~-cyclohexyl-N~2~-[5-(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]-N~1~-methylethane-1,2-diamine
N~1~-cyclohexyl-N~2~-[5-(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]-N~1~-methylethane-1,2-diamine
Compound characteristics
| Compound ID: | G540-0662 |
| Compound Name: | N~1~-cyclohexyl-N~2~-[5-(4-methoxyphenyl)thieno[2,3-d]pyrimidin-4-yl]-N~1~-methylethane-1,2-diamine |
| Molecular Weight: | 396.55 |
| Molecular Formula: | C22 H28 N4 O S |
| Smiles: | CN(CCNc1c2c(csc2ncn1)c1ccc(cc1)OC)C1CCCCC1 |
| Stereo: | ACHIRAL |
| logP: | 5.0955 |
| logD: | 3.3581 |
| logSw: | -4.8867 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.179 |
| InChI Key: | AOJJQIOIMJFJAB-UHFFFAOYSA-N |