5-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl]thieno[2,3-d]pyrimidin-4-amine
Chemical Structure Depiction of
5-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl]thieno[2,3-d]pyrimidin-4-amine
5-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl]thieno[2,3-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | G540-0917 |
| Compound Name: | 5-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| Molecular Weight: | 400.33 |
| Molecular Formula: | C20 H15 Cl2 N3 S |
| Smiles: | C(CNc1c2c(csc2ncn1)c1ccc(cc1)[Cl])c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.3153 |
| logD: | 6.3141 |
| logSw: | -6.7236 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.5972 |
| InChI Key: | HHRYWOFXINLDMG-UHFFFAOYSA-N |