N-(5-chloro-2-methylphenyl)-6-(4-ethylphenyl)-3-methyl-1-phenyl-1,4-dihydropyrazolo[4,3-f]pyrrolo[1,2-a][1,4]diazepine-5(6H)-carboxamide
Chemical Structure Depiction of
N-(5-chloro-2-methylphenyl)-6-(4-ethylphenyl)-3-methyl-1-phenyl-1,4-dihydropyrazolo[4,3-f]pyrrolo[1,2-a][1,4]diazepine-5(6H)-carboxamide
N-(5-chloro-2-methylphenyl)-6-(4-ethylphenyl)-3-methyl-1-phenyl-1,4-dihydropyrazolo[4,3-f]pyrrolo[1,2-a][1,4]diazepine-5(6H)-carboxamide
Compound characteristics
| Compound ID: | G544-1183 |
| Compound Name: | N-(5-chloro-2-methylphenyl)-6-(4-ethylphenyl)-3-methyl-1-phenyl-1,4-dihydropyrazolo[4,3-f]pyrrolo[1,2-a][1,4]diazepine-5(6H)-carboxamide |
| Molecular Weight: | 536.08 |
| Molecular Formula: | C32 H30 Cl N5 O |
| Smiles: | CCc1ccc(cc1)C1c2cccn2c2c(CN1C(Nc1cc(ccc1C)[Cl])=O)c(C)nn2c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.8262 |
| logD: | 7.8262 |
| logSw: | -6.427 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.298 |
| InChI Key: | KLCMQQKJCVOIKH-SSEXGKCCSA-N |