N-(2,4-dimethoxyphenyl)-3-ethyl-6-(3-methylphenyl)-1-phenyl-1,4-dihydropyrazolo[4,3-f]pyrrolo[1,2-a][1,4]diazepine-5(6H)-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-3-ethyl-6-(3-methylphenyl)-1-phenyl-1,4-dihydropyrazolo[4,3-f]pyrrolo[1,2-a][1,4]diazepine-5(6H)-carboxamide
N-(2,4-dimethoxyphenyl)-3-ethyl-6-(3-methylphenyl)-1-phenyl-1,4-dihydropyrazolo[4,3-f]pyrrolo[1,2-a][1,4]diazepine-5(6H)-carboxamide
Compound characteristics
| Compound ID: | G544-1608 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-3-ethyl-6-(3-methylphenyl)-1-phenyl-1,4-dihydropyrazolo[4,3-f]pyrrolo[1,2-a][1,4]diazepine-5(6H)-carboxamide |
| Molecular Weight: | 547.66 |
| Molecular Formula: | C33 H33 N5 O3 |
| Smiles: | CCc1c2CN(C(c3cccc(C)c3)c3cccn3c2n(c2ccccc2)n1)C(Nc1ccc(cc1OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.3161 |
| logD: | 7.3161 |
| logSw: | -5.6507 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.161 |
| InChI Key: | VBGUOCMWUACNKP-WJOKGBTCSA-N |