4-(dimethylamino)-3-(dimethylsulfamoyl)-N-(3-methylbutyl)benzamide
Chemical Structure Depiction of
4-(dimethylamino)-3-(dimethylsulfamoyl)-N-(3-methylbutyl)benzamide
4-(dimethylamino)-3-(dimethylsulfamoyl)-N-(3-methylbutyl)benzamide
Compound characteristics
| Compound ID: | G554-0665 |
| Compound Name: | 4-(dimethylamino)-3-(dimethylsulfamoyl)-N-(3-methylbutyl)benzamide |
| Molecular Weight: | 341.47 |
| Molecular Formula: | C16 H27 N3 O3 S |
| Smiles: | CC(C)CCNC(c1ccc(c(c1)S(N(C)C)(=O)=O)N(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.346 |
| logD: | 2.346 |
| logSw: | -2.9835 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.932 |
| InChI Key: | UWMFJENYDKUYMZ-UHFFFAOYSA-N |