N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-2H-1,3-benzodioxole-5-carboxamide
Chemical Structure Depiction of
N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-2H-1,3-benzodioxole-5-carboxamide
N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-2H-1,3-benzodioxole-5-carboxamide
Compound characteristics
| Compound ID: | G569-0033 |
| Compound Name: | N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-2H-1,3-benzodioxole-5-carboxamide |
| Molecular Weight: | 384.43 |
| Molecular Formula: | C20 H17 F N2 O3 S |
| Smiles: | Cc1c(CCNC(c2ccc3c(c2)OCO3)=O)sc(c2ccc(cc2)F)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.1537 |
| logD: | 4.1537 |
| logSw: | -4.2584 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.919 |
| InChI Key: | UDKZVKLGWQFEKN-UHFFFAOYSA-N |