N-{2-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-3-methoxybenzamide
Chemical Structure Depiction of
N-{2-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-3-methoxybenzamide
N-{2-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-3-methoxybenzamide
Compound characteristics
| Compound ID: | G569-0064 |
| Compound Name: | N-{2-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-3-methoxybenzamide |
| Molecular Weight: | 386.9 |
| Molecular Formula: | C20 H19 Cl N2 O2 S |
| Smiles: | Cc1c(CCNC(c2cccc(c2)OC)=O)sc(c2ccc(cc2)[Cl])n1 |
| Stereo: | ACHIRAL |
| logP: | 4.8591 |
| logD: | 4.8591 |
| logSw: | -4.9113 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.348 |
| InChI Key: | SWIXGXOFYRYUTG-UHFFFAOYSA-N |