N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}acetamide
Chemical Structure Depiction of
N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}acetamide
N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}acetamide
Compound characteristics
| Compound ID: | G569-0138 |
| Compound Name: | N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}acetamide |
| Molecular Weight: | 278.35 |
| Molecular Formula: | C14 H15 F N2 O S |
| Smiles: | CC(NCCc1c(C)nc(c2ccc(cc2)F)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5068 |
| logD: | 2.5068 |
| logSw: | -2.7686 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.975 |
| InChI Key: | QQBMBSITINRGAT-UHFFFAOYSA-N |