2-(2-fluorophenoxy)-N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}acetamide
Chemical Structure Depiction of
2-(2-fluorophenoxy)-N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}acetamide
2-(2-fluorophenoxy)-N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}acetamide
Compound characteristics
| Compound ID: | G569-0148 |
| Compound Name: | 2-(2-fluorophenoxy)-N-{2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}acetamide |
| Molecular Weight: | 388.43 |
| Molecular Formula: | C20 H18 F2 N2 O2 S |
| Smiles: | Cc1c(CCNC(COc2ccccc2F)=O)sc(c2ccc(cc2)F)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.0425 |
| logD: | 4.0425 |
| logSw: | -4.1732 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.176 |
| InChI Key: | ISGPWEKVBRJRJP-UHFFFAOYSA-N |