3-fluoro-N-{2-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}benzamide
Chemical Structure Depiction of
3-fluoro-N-{2-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}benzamide
3-fluoro-N-{2-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}benzamide
Compound characteristics
| Compound ID: | G569-0189 |
| Compound Name: | 3-fluoro-N-{2-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}benzamide |
| Molecular Weight: | 358.41 |
| Molecular Formula: | C19 H16 F2 N2 O S |
| Smiles: | Cc1c(CCNC(c2cccc(c2)F)=O)sc(c2cccc(c2)F)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.4285 |
| logD: | 4.4285 |
| logSw: | -4.3108 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.804 |
| InChI Key: | FRDWSCDGJRFXJG-UHFFFAOYSA-N |