N~1~-{2-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-N~2~-phenylethanediamide
Chemical Structure Depiction of
N~1~-{2-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-N~2~-phenylethanediamide
N~1~-{2-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-N~2~-phenylethanediamide
Compound characteristics
| Compound ID: | G569-0336 |
| Compound Name: | N~1~-{2-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl}-N~2~-phenylethanediamide |
| Molecular Weight: | 383.44 |
| Molecular Formula: | C20 H18 F N3 O2 S |
| Smiles: | Cc1c(CCNC(C(Nc2ccccc2)=O)=O)sc(c2cccc(c2)F)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.612 |
| logD: | 3.5221 |
| logSw: | -3.9502 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 58.167 |
| InChI Key: | GKGXUIKCEGQUMD-UHFFFAOYSA-N |