4-fluoro-2-methyl-N-{2-[2-(thiophen-2-yl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}benzene-1-sulfonamide
Chemical Structure Depiction of
4-fluoro-2-methyl-N-{2-[2-(thiophen-2-yl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}benzene-1-sulfonamide
4-fluoro-2-methyl-N-{2-[2-(thiophen-2-yl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G572-0047 |
| Compound Name: | 4-fluoro-2-methyl-N-{2-[2-(thiophen-2-yl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}benzene-1-sulfonamide |
| Molecular Weight: | 422.52 |
| Molecular Formula: | C17 H15 F N4 O2 S3 |
| Smiles: | Cc1cc(ccc1S(NCCc1csc2nc(c3cccs3)nn12)(=O)=O)F |
| Stereo: | ACHIRAL |
| logP: | 4.0644 |
| logD: | 4.0643 |
| logSw: | -4.0581 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.061 |
| InChI Key: | BFUVMLUCQFPAKO-UHFFFAOYSA-N |