N-{2-[2-(3-fluorophenyl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}thiophene-2-sulfonamide
Chemical Structure Depiction of
N-{2-[2-(3-fluorophenyl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}thiophene-2-sulfonamide
N-{2-[2-(3-fluorophenyl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | G572-0185 |
| Compound Name: | N-{2-[2-(3-fluorophenyl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}thiophene-2-sulfonamide |
| Molecular Weight: | 408.49 |
| Molecular Formula: | C16 H13 F N4 O2 S3 |
| Smiles: | C(CNS(c1cccs1)(=O)=O)c1csc2nc(c3cccc(c3)F)nn12 |
| Stereo: | ACHIRAL |
| logP: | 3.635 |
| logD: | 3.6348 |
| logSw: | -4.0356 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.061 |
| InChI Key: | DETFUKLZZOCXAG-UHFFFAOYSA-N |