4-butoxy-N-{2-[2-(2-methylphenyl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}benzamide
Chemical Structure Depiction of
4-butoxy-N-{2-[2-(2-methylphenyl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}benzamide
4-butoxy-N-{2-[2-(2-methylphenyl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}benzamide
Compound characteristics
| Compound ID: | G574-0160 |
| Compound Name: | 4-butoxy-N-{2-[2-(2-methylphenyl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl]ethyl}benzamide |
| Molecular Weight: | 434.56 |
| Molecular Formula: | C24 H26 N4 O2 S |
| Smiles: | CCCCOc1ccc(cc1)C(NCCc1csc2nc(c3ccccc3C)nn12)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0385 |
| logD: | 5.0385 |
| logSw: | -4.5227 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.115 |
| InChI Key: | NYORYZCDGGCVDQ-UHFFFAOYSA-N |