ethyl 4-(2-chloro-4-methylanilino)-3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate
Chemical Structure Depiction of
ethyl 4-(2-chloro-4-methylanilino)-3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate
ethyl 4-(2-chloro-4-methylanilino)-3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | G583-1954 |
| Compound Name: | ethyl 4-(2-chloro-4-methylanilino)-3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate |
| Molecular Weight: | 426.83 |
| Molecular Formula: | C21 H16 Cl F N4 O3 |
| Smiles: | CCOC(c1nc(c2c(c3ccc(cc3)F)noc2n1)Nc1ccc(C)cc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.5557 |
| logD: | 5.5557 |
| logSw: | -5.991 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.518 |
| InChI Key: | QXKBJXNYOPHQMB-UHFFFAOYSA-N |