N-[(4-ethylphenyl)methyl]-1-(1-methyl-1H-indole-5-sulfonyl)piperidine-4-carboxamide
Chemical Structure Depiction of
N-[(4-ethylphenyl)methyl]-1-(1-methyl-1H-indole-5-sulfonyl)piperidine-4-carboxamide
N-[(4-ethylphenyl)methyl]-1-(1-methyl-1H-indole-5-sulfonyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | G585-0582 |
| Compound Name: | N-[(4-ethylphenyl)methyl]-1-(1-methyl-1H-indole-5-sulfonyl)piperidine-4-carboxamide |
| Molecular Weight: | 439.58 |
| Molecular Formula: | C24 H29 N3 O3 S |
| Smiles: | CCc1ccc(CNC(C2CCN(CC2)S(c2ccc3c(ccn3C)c2)(=O)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.5712 |
| logD: | 3.5712 |
| logSw: | -3.5813 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.029 |
| InChI Key: | CSVXYEUVOYHSSS-UHFFFAOYSA-N |