N-[3-(diethylamino)propyl]-6-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline-3-carboxamide
Chemical Structure Depiction of
N-[3-(diethylamino)propyl]-6-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline-3-carboxamide
N-[3-(diethylamino)propyl]-6-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline-3-carboxamide
Compound characteristics
| Compound ID: | G587-0087 |
| Compound Name: | N-[3-(diethylamino)propyl]-6-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline-3-carboxamide |
| Molecular Weight: | 358.48 |
| Molecular Formula: | C20 H30 N4 O2 |
| Smiles: | CCN(CC)CCCNC(c1ccc2c(c1)NC(C1CCCCN12)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1024 |
| logD: | -0.6187 |
| logSw: | -2.9144 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.504 |
| InChI Key: | MDMASYHXBMJICV-SFHVURJKSA-N |