N-(3-bromophenyl)-N'-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)urea
Chemical Structure Depiction of
N-(3-bromophenyl)-N'-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)urea
N-(3-bromophenyl)-N'-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)urea
Compound characteristics
| Compound ID: | G588-0292 |
| Compound Name: | N-(3-bromophenyl)-N'-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)urea |
| Molecular Weight: | 380.3 |
| Molecular Formula: | C16 H18 Br N3 O S |
| Smiles: | C1CCCc2c(CC1)nc(NC(Nc1cccc(c1)[Br])=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 6.0667 |
| logD: | 5.988 |
| logSw: | -5.7585 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 44.34 |
| InChI Key: | KQZZGUSOUSXCCD-UHFFFAOYSA-N |