N-[(4-ethylphenyl)methyl]-4-oxo-6,7,8,9-tetrahydro-4H-pyrimido[2,1-b][1,3]benzothiazole-3-carboxamide
Chemical Structure Depiction of
N-[(4-ethylphenyl)methyl]-4-oxo-6,7,8,9-tetrahydro-4H-pyrimido[2,1-b][1,3]benzothiazole-3-carboxamide
N-[(4-ethylphenyl)methyl]-4-oxo-6,7,8,9-tetrahydro-4H-pyrimido[2,1-b][1,3]benzothiazole-3-carboxamide
Compound characteristics
| Compound ID: | G595-0331 |
| Compound Name: | N-[(4-ethylphenyl)methyl]-4-oxo-6,7,8,9-tetrahydro-4H-pyrimido[2,1-b][1,3]benzothiazole-3-carboxamide |
| Molecular Weight: | 367.47 |
| Molecular Formula: | C20 H21 N3 O2 S |
| Smiles: | CCc1ccc(CNC(C2=CN=C3N(C4CCCCC=4S3)C2=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.8125 |
| logD: | 2.7681 |
| logSw: | -3.2368 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.037 |
| InChI Key: | QMKVJUJBPXAWMI-UHFFFAOYSA-N |