5-{[2-(2-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-3-methyl[1,2]oxazolo[5,4-d]pyrimidin-4(5H)-one
Chemical Structure Depiction of
5-{[2-(2-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-3-methyl[1,2]oxazolo[5,4-d]pyrimidin-4(5H)-one
5-{[2-(2-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-3-methyl[1,2]oxazolo[5,4-d]pyrimidin-4(5H)-one
Compound characteristics
| Compound ID: | G597-0283 |
| Compound Name: | 5-{[2-(2-ethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-3-methyl[1,2]oxazolo[5,4-d]pyrimidin-4(5H)-one |
| Molecular Weight: | 366.37 |
| Molecular Formula: | C19 H18 N4 O4 |
| Smiles: | CCOc1ccccc1c1nc(CN2C=Nc3c(C2=O)c(C)no3)c(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.0693 |
| logD: | 2.0692 |
| logSw: | -2.8531 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 73.112 |
| InChI Key: | VDKYEZHKCWBZDI-UHFFFAOYSA-N |