1-(4-chlorobenzene-1-sulfonyl)-3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine
Chemical Structure Depiction of
1-(4-chlorobenzene-1-sulfonyl)-3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine
1-(4-chlorobenzene-1-sulfonyl)-3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine
Compound characteristics
| Compound ID: | G603-0090 |
| Compound Name: | 1-(4-chlorobenzene-1-sulfonyl)-3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidine |
| Molecular Weight: | 447.94 |
| Molecular Formula: | C21 H22 Cl N3 O4 S |
| Smiles: | CCOc1ccc(cc1)c1nc(C2CCCN(C2)S(c2ccc(cc2)[Cl])(=O)=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2775 |
| logD: | 5.2775 |
| logSw: | -6.0017 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 70.412 |
| InChI Key: | XXKUGURXLSTOHF-INIZCTEOSA-N |