1-(4-chlorobenzene-1-sulfonyl)-3-{3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}piperidine
					Chemical Structure Depiction of
1-(4-chlorobenzene-1-sulfonyl)-3-{3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}piperidine
			1-(4-chlorobenzene-1-sulfonyl)-3-{3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}piperidine
Compound characteristics
| Compound ID: | G603-0109 | 
| Compound Name: | 1-(4-chlorobenzene-1-sulfonyl)-3-{3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}piperidine | 
| Molecular Weight: | 471.88 | 
| Molecular Formula: | C20 H17 Cl F3 N3 O3 S | 
| Smiles: | C1CC(CN(C1)S(c1ccc(cc1)[Cl])(=O)=O)c1nc(c2ccc(cc2)C(F)(F)F)no1 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 5.7813 | 
| logD: | 5.7813 | 
| logSw: | -6.3684 | 
| Hydrogen bond acceptors count: | 8 | 
| Polar surface area: | 63.289 | 
| InChI Key: | PCCGCZUVPKADAH-AWEZNQCLSA-N | 
 
				 
				