3-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}-1-[4-(propan-2-yl)benzene-1-sulfonyl]piperidine
Chemical Structure Depiction of
3-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}-1-[4-(propan-2-yl)benzene-1-sulfonyl]piperidine
3-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}-1-[4-(propan-2-yl)benzene-1-sulfonyl]piperidine
Compound characteristics
| Compound ID: | G603-0330 |
| Compound Name: | 3-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}-1-[4-(propan-2-yl)benzene-1-sulfonyl]piperidine |
| Molecular Weight: | 457.61 |
| Molecular Formula: | C23 H27 N3 O3 S2 |
| Smiles: | CC(C)c1ccc(cc1)S(N1CCCC(C1)c1nc(c2ccc(cc2)SC)no1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.3713 |
| logD: | 6.3713 |
| logSw: | -5.718 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 63.289 |
| InChI Key: | WQNSMCFWGINWMI-IBGZPJMESA-N |