N-[(4-ethoxy-3-methoxyphenyl)methyl]-5-methyl-2-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Chemical Structure Depiction of
N-[(4-ethoxy-3-methoxyphenyl)methyl]-5-methyl-2-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
N-[(4-ethoxy-3-methoxyphenyl)methyl]-5-methyl-2-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Compound characteristics
| Compound ID: | G608-0021 |
| Compound Name: | N-[(4-ethoxy-3-methoxyphenyl)methyl]-5-methyl-2-(4-methylphenyl)[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| Molecular Weight: | 403.48 |
| Molecular Formula: | C23 H25 N5 O2 |
| Smiles: | CCOc1ccc(CNc2cc(C)nc3nc(c4ccc(C)cc4)nn23)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 4.037 |
| logD: | 3.9533 |
| logSw: | -4.0311 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.003 |
| InChI Key: | BGYDFYSDKIGEAV-UHFFFAOYSA-N |