[3-amino-5-(2,4-dimethylanilino)-4-(4-methylbenzene-1-sulfonyl)thiophen-2-yl](3-methoxyphenyl)methanone
Chemical Structure Depiction of
[3-amino-5-(2,4-dimethylanilino)-4-(4-methylbenzene-1-sulfonyl)thiophen-2-yl](3-methoxyphenyl)methanone
[3-amino-5-(2,4-dimethylanilino)-4-(4-methylbenzene-1-sulfonyl)thiophen-2-yl](3-methoxyphenyl)methanone
Compound characteristics
| Compound ID: | G613-0152 |
| Compound Name: | [3-amino-5-(2,4-dimethylanilino)-4-(4-methylbenzene-1-sulfonyl)thiophen-2-yl](3-methoxyphenyl)methanone |
| Molecular Weight: | 506.64 |
| Molecular Formula: | C27 H26 N2 O4 S2 |
| Smiles: | Cc1ccc(cc1)S(c1c(c(C(c2cccc(c2)OC)=O)sc1Nc1ccc(C)cc1C)N)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.39 |
| logD: | 6.39 |
| logSw: | -5.6059 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 78.145 |
| InChI Key: | LTKVDLGMIZWIJQ-UHFFFAOYSA-N |