2-{[4-ethyl-3-methyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-1-[4-(4-fluorophenyl)piperazin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-{[4-ethyl-3-methyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-1-[4-(4-fluorophenyl)piperazin-1-yl]ethan-1-one
2-{[4-ethyl-3-methyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-1-[4-(4-fluorophenyl)piperazin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | G614-0814 |
| Compound Name: | 2-{[4-ethyl-3-methyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-6-yl]oxy}-1-[4-(4-fluorophenyl)piperazin-1-yl]ethan-1-one |
| Molecular Weight: | 487.58 |
| Molecular Formula: | C28 H30 F N5 O2 |
| Smiles: | CCc1cc(nc2c1c(C)nn2c1ccc(C)cc1)OCC(N1CCN(CC1)c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9962 |
| logD: | 4.9962 |
| logSw: | -4.9549 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 50.415 |
| InChI Key: | DICRXNBRYXJVSC-UHFFFAOYSA-N |