N-[4-(6-ethoxypyridazin-3-yl)phenyl]-4-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-[4-(6-ethoxypyridazin-3-yl)phenyl]-4-methylbenzene-1-sulfonamide
N-[4-(6-ethoxypyridazin-3-yl)phenyl]-4-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | G619-0545 |
| Compound Name: | N-[4-(6-ethoxypyridazin-3-yl)phenyl]-4-methylbenzene-1-sulfonamide |
| Molecular Weight: | 369.44 |
| Molecular Formula: | C19 H19 N3 O3 S |
| Smiles: | CCOc1ccc(c2ccc(cc2)NS(c2ccc(C)cc2)(=O)=O)nn1 |
| Stereo: | ACHIRAL |
| logP: | 4.1886 |
| logD: | 4.1798 |
| logSw: | -4.1017 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.383 |
| InChI Key: | PRRNTJIIBICGIM-UHFFFAOYSA-N |