(2-{[(4-fluorophenyl)methyl]sulfanyl}-1-[(4-methoxyphenyl)methyl]-1H-imidazol-5-yl)methanol
Chemical Structure Depiction of
(2-{[(4-fluorophenyl)methyl]sulfanyl}-1-[(4-methoxyphenyl)methyl]-1H-imidazol-5-yl)methanol
(2-{[(4-fluorophenyl)methyl]sulfanyl}-1-[(4-methoxyphenyl)methyl]-1H-imidazol-5-yl)methanol
Compound characteristics
| Compound ID: | G621-0510 |
| Compound Name: | (2-{[(4-fluorophenyl)methyl]sulfanyl}-1-[(4-methoxyphenyl)methyl]-1H-imidazol-5-yl)methanol |
| Molecular Weight: | 358.43 |
| Molecular Formula: | C19 H19 F N2 O2 S |
| Smiles: | COc1ccc(Cn2c(CO)cnc2SCc2ccc(cc2)F)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3681 |
| logD: | 3.363 |
| logSw: | -3.203 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.903 |
| InChI Key: | UFUOWXTYSKSPKA-UHFFFAOYSA-N |