N-[(furan-2-yl)methyl]-1-methyl-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-1-methyl-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
N-[(furan-2-yl)methyl]-1-methyl-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
Compound characteristics
| Compound ID: | G636-0846 |
| Compound Name: | N-[(furan-2-yl)methyl]-1-methyl-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide |
| Molecular Weight: | 351.42 |
| Molecular Formula: | C16 H21 N3 O4 S |
| Smiles: | Cn1cc(cc1C(NCc1ccco1)=O)S(N1CCCCC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8019 |
| logD: | 1.8018 |
| logSw: | -2.5083 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.421 |
| InChI Key: | NEATWXJUJYCGOY-UHFFFAOYSA-N |